C29H33F3N4O7S — CID 170451376
2-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanyl-2-(4-hydroxyoxan-4-yl)-N-methyl-3-phenylpropanamide (PubChem CID 170451376) has the molecular formula C29H33F3N4O7S and a molecular weight of 638.67 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanyl-2-(4-hydroxyoxan-4-yl)-N-methyl-3-phenylpropanamide.
| Compound Name | 2-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanyl-2-(4-hydroxyoxan-4-yl)-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 170451376 |
| Molecular Formula | C29H33F3N4O7S |
| Molecular Weight | 638.67 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | 2-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanyl-2-(4-hydroxyoxan-4-yl)-N-methyl-3-phenylpropanamide |
| SMILES | CNC(=O)C(Cc1ccccc1)(S[C@@H]1O[C@H](CO)[C@H](O)[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O)C1(O)CCOCC1 |
| InChI | InChI=1S/C29H33F3N4O7S/c1-33-27(40)29(13-16-5-3-2-4-6-16,28(41)7-9-42-10-8-28)44-26-25(39)23(24(38)21(15-37)43-26)36-14-20(34-35-36)17-11-18(30)22(32)19(31)12-17/h2-6,11-12,14,21,23-26,37-39,41H,7-10,13,15H2,1H3,(H,33,40)/t21-,23+,24+,25-,26+,29?/m1/s1 |
| InChIKey | TXSVMZLVVIVKRD-YVEDTRKQSA-N |
| XLogP | 1.34 |
| TPSA | 159.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.67 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|