C21H20N2O4S — CID 157198973
7-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxoheptanamide (PubChem CID 157198973) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is 7-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxoheptanamide.
| Compound Name | 7-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxoheptanamide |
|---|---|
| PubChem CID | 157198973 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 7-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxoheptanamide |
| SMILES | NC(=O)CCC(=O)CCCOc1ccc(C(=O)c2ccc(N=C=S)cc2)cc1 |
| InChI | InChI=1S/C21H20N2O4S/c22-20(25)12-9-18(24)2-1-13-27-19-10-5-16(6-11-19)21(26)15-3-7-17(8-4-15)23-14-28/h3-8,10-11H,1-2,9,12-13H2,(H2,22,25) |
| InChIKey | VQKIFJPRARKNAV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|