C19H17NO6S2 — CID 157319659
5-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxopentane-1-sulfonic acid (PubChem CID 157319659) has the molecular formula C19H17NO6S2 and a molecular weight of 419.48 g/mol. Its IUPAC name is 5-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxopentane-1-sulfonic acid.
| Compound Name | 5-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxopentane-1-sulfonic acid |
|---|---|
| PubChem CID | 157319659 |
| Molecular Formula | C19H17NO6S2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 5-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxopentane-1-sulfonic acid |
| SMILES | O=C(CCCS(=O)(=O)O)COc1ccc(C(=O)c2ccc(N=C=S)cc2)cc1 |
| InChI | InChI=1S/C19H17NO6S2/c21-17(2-1-11-28(23,24)25)12-26-18-9-5-15(6-10-18)19(22)14-3-7-16(8-4-14)20-13-27/h3-10H,1-2,11-12H2,(H,23,24,25) |
| InChIKey | CCELURVRLJRBRA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|