C22H20N2O7S — CID 71536687
2-[[3-[4-(4-isothiocyanatobenzoyl)phenoxy]-2-methylpropanoyl]amino]butanedioic acid (PubChem CID 71536687) has the molecular formula C22H20N2O7S and a molecular weight of 456.48 g/mol. Its IUPAC name is 2-[[3-[4-(4-isothiocyanatobenzoyl)phenoxy]-2-methylpropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[3-[4-(4-isothiocyanatobenzoyl)phenoxy]-2-methylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 71536687 |
| Molecular Formula | C22H20N2O7S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 2-[[3-[4-(4-isothiocyanatobenzoyl)phenoxy]-2-methylpropanoyl]amino]butanedioic acid |
| SMILES | CC(COc1ccc(C(=O)c2ccc(N=C=S)cc2)cc1)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H20N2O7S/c1-13(21(28)24-18(22(29)30)10-19(25)26)11-31-17-8-4-15(5-9-17)20(27)14-2-6-16(7-3-14)23-12-32/h2-9,13,18H,10-11H2,1H3,(H,24,28)(H,25,26)(H,29,30) |
| InChIKey | BODVOWVXBAXHQD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 142.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|