C18H18N3O3- — CID 58868741
2-[4-[(E)-2-[4-(dimethylaminodiazenyl)phenyl]ethenyl]phenoxy]acetate (PubChem CID 58868741) has the molecular formula C18H18N3O3- and a molecular weight of 324.36 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-(dimethylaminodiazenyl)phenyl]ethenyl]phenoxy]acetate.
| Compound Name | 2-[4-[(E)-2-[4-(dimethylaminodiazenyl)phenyl]ethenyl]phenoxy]acetate |
|---|---|
| PubChem CID | 58868741 |
| Molecular Formula | C18H18N3O3- |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-[4-[(E)-2-[4-(dimethylaminodiazenyl)phenyl]ethenyl]phenoxy]acetate |
| SMILES | CN(C)/N=N/c1ccc(/C=C/c2ccc(OCC(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C18H19N3O3/c1-21(2)20-19-16-9-5-14(6-10-16)3-4-15-7-11-17(12-8-15)24-13-18(22)23/h3-12H,13H2,1-2H3,(H,22,23)/p-1/b4-3+,20-19+ |
| InChIKey | JWCPRXWUVVNUCW-LAOKIPRWSA-M |
| XLogP | 2.55 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|