C14H17N5O6 — CID 71449718
(2S)-2-[[[(4-carbamoylphenyl)diazenyl]-methylcarbamoyl]amino]pentanedioic acid (PubChem CID 71449718) has the molecular formula C14H17N5O6 and a molecular weight of 351.32 g/mol. Its IUPAC name is (2S)-2-[[[(4-carbamoylphenyl)diazenyl]-methylcarbamoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[[(4-carbamoylphenyl)diazenyl]-methylcarbamoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 71449718 |
| Molecular Formula | C14H17N5O6 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (2S)-2-[[[(4-carbamoylphenyl)diazenyl]-methylcarbamoyl]amino]pentanedioic acid |
| SMILES | CN(/N=N/c1ccc(C(N)=O)cc1)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H17N5O6/c1-19(14(25)16-10(13(23)24)6-7-11(20)21)18-17-9-4-2-8(3-5-9)12(15)22/h2-5,10H,6-7H2,1H3,(H2,15,22)(H,16,25)(H,20,21)(H,23,24)/b18-17+/t10-/m0/s1 |
| InChIKey | ZYSCLAXTXJEDMC-ZRQYBVSLSA-N |
| XLogP | 0.74 |
| TPSA | 174.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|