C21H22N2O6S — CID 4910874
2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 4910874) has the molecular formula C21H22N2O6S and a molecular weight of 430.48 g/mol. Its IUPAC name is 2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 4910874 |
| Molecular Formula | C21H22N2O6S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | Cc1c(C)c2ccc(OCC(=O)NCCc3ccc(S(N)(=O)=O)cc3)cc2oc1=O |
| InChI | InChI=1S/C21H22N2O6S/c1-13-14(2)21(25)29-19-11-16(5-8-18(13)19)28-12-20(24)23-10-9-15-3-6-17(7-4-15)30(22,26)27/h3-8,11H,9-10,12H2,1-2H3,(H,23,24)(H2,22,26,27) |
| InChIKey | CDDQCWPMMZQCGS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|