C22H27N5O4 — CID 171912201
4-ethyl-7-[1-oxo-1-[4-[2-(1,2,4-triazol-1-yl)ethyl]piperazin-1-yl]propan-2-yl]oxychromen-2-one (PubChem CID 171912201) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is 4-ethyl-7-[1-oxo-1-[4-[2-(1,2,4-triazol-1-yl)ethyl]piperazin-1-yl]propan-2-yl]oxychromen-2-one.
| Compound Name | 4-ethyl-7-[1-oxo-1-[4-[2-(1,2,4-triazol-1-yl)ethyl]piperazin-1-yl]propan-2-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 171912201 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 4-ethyl-7-[1-oxo-1-[4-[2-(1,2,4-triazol-1-yl)ethyl]piperazin-1-yl]propan-2-yl]oxychromen-2-one |
| SMILES | CCc1cc(=O)oc2cc(OC(C)C(=O)N3CCN(CCn4cncn4)CC3)ccc12 |
| InChI | InChI=1S/C22H27N5O4/c1-3-17-12-21(28)31-20-13-18(4-5-19(17)20)30-16(2)22(29)26-9-6-25(7-10-26)8-11-27-15-23-14-24-27/h4-5,12-16H,3,6-11H2,1-2H3 |
| InChIKey | QDPGOCBMFPULHB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 93.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|