C24H26N2O5 — CID 171386816
4-ethyl-7-[2-[4-[hydroxy(pyridin-2-yl)methyl]piperidin-1-yl]-2-oxoethoxy]chromen-2-one (PubChem CID 171386816) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 4-ethyl-7-[2-[4-[hydroxy(pyridin-2-yl)methyl]piperidin-1-yl]-2-oxoethoxy]chromen-2-one.
| Compound Name | 4-ethyl-7-[2-[4-[hydroxy(pyridin-2-yl)methyl]piperidin-1-yl]-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 171386816 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 4-ethyl-7-[2-[4-[hydroxy(pyridin-2-yl)methyl]piperidin-1-yl]-2-oxoethoxy]chromen-2-one |
| SMILES | CCc1cc(=O)oc2cc(OCC(=O)N3CCC(C(O)c4ccccn4)CC3)ccc12 |
| InChI | InChI=1S/C24H26N2O5/c1-2-16-13-23(28)31-21-14-18(6-7-19(16)21)30-15-22(27)26-11-8-17(9-12-26)24(29)20-5-3-4-10-25-20/h3-7,10,13-14,17,24,29H,2,8-9,11-12,15H2,1H3 |
| InChIKey | KDIXDCJREBQJDH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|