C23H23ClN2O6S — CID 4673261
N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide (PubChem CID 4673261) has the molecular formula C23H23ClN2O6S and a molecular weight of 490.97 g/mol. Its IUPAC name is N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 4673261 |
| Molecular Formula | C23H23ClN2O6S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)Nc3cc(S(=O)(=O)N4CCCCC4)ccc3Cl)ccc12 |
| InChI | InChI=1S/C23H23ClN2O6S/c1-15-11-23(28)32-21-12-16(5-7-18(15)21)31-14-22(27)25-20-13-17(6-8-19(20)24)33(29,30)26-9-3-2-4-10-26/h5-8,11-13H,2-4,9-10,14H2,1H3,(H,25,27) |
| InChIKey | BNIACECNGFAVOV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|