C23H26N2O7S — CID 2946893
N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide (PubChem CID 2946893) has the molecular formula C23H26N2O7S and a molecular weight of 474.54 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 2946893 |
| Molecular Formula | C23H26N2O7S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)COc2ccc3c(C)cc(=O)oc3c2)c1 |
| InChI | InChI=1S/C23H26N2O7S/c1-5-25(6-2)33(28,29)17-8-10-20(30-4)19(13-17)24-22(26)14-31-16-7-9-18-15(3)11-23(27)32-21(18)12-16/h7-13H,5-6,14H2,1-4H3,(H,24,26) |
| InChIKey | SMHOEZZAXOTQSA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|