C22H21NO6S — CID 2478012
(4-methyl-2-oxochromen-7-yl) 3-piperidin-1-ylsulfonylbenzoate (PubChem CID 2478012) has the molecular formula C22H21NO6S and a molecular weight of 427.48 g/mol. Its IUPAC name is (4-methyl-2-oxochromen-7-yl) 3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (4-methyl-2-oxochromen-7-yl) 3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2478012 |
| Molecular Formula | C22H21NO6S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | (4-methyl-2-oxochromen-7-yl) 3-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1cc(=O)oc2cc(OC(=O)c3cccc(S(=O)(=O)N4CCCCC4)c3)ccc12 |
| InChI | InChI=1S/C22H21NO6S/c1-15-12-21(24)29-20-14-17(8-9-19(15)20)28-22(25)16-6-5-7-18(13-16)30(26,27)23-10-3-2-4-11-23/h5-9,12-14H,2-4,10-11H2,1H3 |
| InChIKey | KPIDWWYBUILKRF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|