C23H20N2O7 — CID 55469981
[2-oxo-2-[2-(2-oxopyrrolidin-1-yl)anilino]ethyl] 2-(2-oxochromen-7-yl)oxyacetate (PubChem CID 55469981) has the molecular formula C23H20N2O7 and a molecular weight of 436.42 g/mol. Its IUPAC name is [2-oxo-2-[2-(2-oxopyrrolidin-1-yl)anilino]ethyl] 2-(2-oxochromen-7-yl)oxyacetate.
| Compound Name | [2-oxo-2-[2-(2-oxopyrrolidin-1-yl)anilino]ethyl] 2-(2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 55469981 |
| Molecular Formula | C23H20N2O7 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | [2-oxo-2-[2-(2-oxopyrrolidin-1-yl)anilino]ethyl] 2-(2-oxochromen-7-yl)oxyacetate |
| SMILES | O=C(COC(=O)COc1ccc2ccc(=O)oc2c1)Nc1ccccc1N1CCCC1=O |
| InChI | InChI=1S/C23H20N2O7/c26-20(24-17-4-1-2-5-18(17)25-11-3-6-21(25)27)13-31-23(29)14-30-16-9-7-15-8-10-22(28)32-19(15)12-16/h1-2,4-5,7-10,12H,3,6,11,13-14H2,(H,24,26) |
| InChIKey | UIARIAILBIQJMM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|