C22H24N2O5 — CID 55468169
[2-oxo-2-[2-(2-oxopyrrolidin-1-yl)anilino]ethyl] 2-(2-ethylphenoxy)acetate (PubChem CID 55468169) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is [2-oxo-2-[2-(2-oxopyrrolidin-1-yl)anilino]ethyl] 2-(2-ethylphenoxy)acetate.
| Compound Name | [2-oxo-2-[2-(2-oxopyrrolidin-1-yl)anilino]ethyl] 2-(2-ethylphenoxy)acetate |
|---|---|
| PubChem CID | 55468169 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [2-oxo-2-[2-(2-oxopyrrolidin-1-yl)anilino]ethyl] 2-(2-ethylphenoxy)acetate |
| SMILES | CCc1ccccc1OCC(=O)OCC(=O)Nc1ccccc1N1CCCC1=O |
| InChI | InChI=1S/C22H24N2O5/c1-2-16-8-3-6-11-19(16)28-15-22(27)29-14-20(25)23-17-9-4-5-10-18(17)24-13-7-12-21(24)26/h3-6,8-11H,2,7,12-15H2,1H3,(H,23,25) |
| InChIKey | ARBXOTRUVGFRFA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |