C16H10Cl2N2O3 — CID 7864825
[2-(3-cyanoanilino)-2-oxoethyl] 3,4-dichlorobenzoate (PubChem CID 7864825) has the molecular formula C16H10Cl2N2O3 and a molecular weight of 349.17 g/mol. Its IUPAC name is [2-(3-cyanoanilino)-2-oxoethyl] 3,4-dichlorobenzoate.
| Compound Name | [2-(3-cyanoanilino)-2-oxoethyl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 7864825 |
| Molecular Formula | C16H10Cl2N2O3 |
| Molecular Weight | 349.17 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | [2-(3-cyanoanilino)-2-oxoethyl] 3,4-dichlorobenzoate |
| SMILES | N#Cc1cccc(NC(=O)COC(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C16H10Cl2N2O3/c17-13-5-4-11(7-14(13)18)16(22)23-9-15(21)20-12-3-1-2-10(6-12)8-19/h1-7H,9H2,(H,20,21) |
| InChIKey | SUQZFQGELMOJPO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.17 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |