C20H15ClN4O3 — CID 33494605
[2-(3-cyanoanilino)-2-oxoethyl] 1-[(2-chlorophenyl)methyl]pyrazole-4-carboxylate (PubChem CID 33494605) has the molecular formula C20H15ClN4O3 and a molecular weight of 394.82 g/mol. Its IUPAC name is [2-(3-cyanoanilino)-2-oxoethyl] 1-[(2-chlorophenyl)methyl]pyrazole-4-carboxylate.
| Compound Name | [2-(3-cyanoanilino)-2-oxoethyl] 1-[(2-chlorophenyl)methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 33494605 |
| Molecular Formula | C20H15ClN4O3 |
| Molecular Weight | 394.82 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [2-(3-cyanoanilino)-2-oxoethyl] 1-[(2-chlorophenyl)methyl]pyrazole-4-carboxylate |
| SMILES | N#Cc1cccc(NC(=O)COC(=O)c2cnn(Cc3ccccc3Cl)c2)c1 |
| InChI | InChI=1S/C20H15ClN4O3/c21-18-7-2-1-5-15(18)11-25-12-16(10-23-25)20(27)28-13-19(26)24-17-6-3-4-14(8-17)9-22/h1-8,10,12H,11,13H2,(H,24,26) |
| InChIKey | CEQPICGIHOOWBI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.82 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |