C14H9ClN2O3S — CID 7146865
[2-(3-cyanoanilino)-2-oxoethyl] 5-chlorothiophene-2-carboxylate (PubChem CID 7146865) has the molecular formula C14H9ClN2O3S and a molecular weight of 320.76 g/mol. Its IUPAC name is [2-(3-cyanoanilino)-2-oxoethyl] 5-chlorothiophene-2-carboxylate.
| Compound Name | [2-(3-cyanoanilino)-2-oxoethyl] 5-chlorothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7146865 |
| Molecular Formula | C14H9ClN2O3S |
| Molecular Weight | 320.76 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | [2-(3-cyanoanilino)-2-oxoethyl] 5-chlorothiophene-2-carboxylate |
| SMILES | N#Cc1cccc(NC(=O)COC(=O)c2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C14H9ClN2O3S/c15-12-5-4-11(21-12)14(19)20-8-13(18)17-10-3-1-2-9(6-10)7-16/h1-6H,8H2,(H,17,18) |
| InChIKey | CCWTXOXWWWNILK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.76 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |