C22H15ClN4O7S — CID 3949475
[2-(3-cyanoanilino)-2-oxoethyl] 4-[(4-chloro-3-nitrophenyl)sulfonylamino]benzoate (PubChem CID 3949475) has the molecular formula C22H15ClN4O7S and a molecular weight of 514.90 g/mol. Its IUPAC name is [2-(3-cyanoanilino)-2-oxoethyl] 4-[(4-chloro-3-nitrophenyl)sulfonylamino]benzoate.
| Compound Name | [2-(3-cyanoanilino)-2-oxoethyl] 4-[(4-chloro-3-nitrophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 3949475 |
| Molecular Formula | C22H15ClN4O7S |
| Molecular Weight | 514.90 g/mol |
| Exact Mass | 514.03 |
| IUPAC Name | [2-(3-cyanoanilino)-2-oxoethyl] 4-[(4-chloro-3-nitrophenyl)sulfonylamino]benzoate |
| SMILES | N#Cc1cccc(NC(=O)COC(=O)c2ccc(NS(=O)(=O)c3ccc(Cl)c([N+](=O)[O-])c3)cc2)c1 |
| InChI | InChI=1S/C22H15ClN4O7S/c23-19-9-8-18(11-20(19)27(30)31)35(32,33)26-16-6-4-15(5-7-16)22(29)34-13-21(28)25-17-3-1-2-14(10-17)12-24/h1-11,26H,13H2,(H,25,28) |
| InChIKey | RFTYHGLZGDTDIL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 168.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.90 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|