C21H21F3N4O2S — CID 55833366
2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide (PubChem CID 55833366) has the molecular formula C21H21F3N4O2S and a molecular weight of 450.49 g/mol. Its IUPAC name is 2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide.
| Compound Name | 2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 55833366 |
| Molecular Formula | C21H21F3N4O2S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
| SMILES | CCOc1ccccc1-c1nc(CC(=O)NCCNc2ncccc2C(F)(F)F)cs1 |
| InChI | InChI=1S/C21H21F3N4O2S/c1-2-30-17-8-4-3-6-15(17)20-28-14(13-31-20)12-18(29)25-10-11-27-19-16(21(22,23)24)7-5-9-26-19/h3-9,13H,2,10-12H2,1H3,(H,25,29)(H,26,27) |
| InChIKey | OWVQQCDFXDFTLC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|