C24H28N2O3S — CID 46536784
2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]-N-[3-(1-phenylethoxy)propyl]acetamide (PubChem CID 46536784) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is 2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]-N-[3-(1-phenylethoxy)propyl]acetamide.
| Compound Name | 2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]-N-[3-(1-phenylethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 46536784 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]-N-[3-(1-phenylethoxy)propyl]acetamide |
| SMILES | CCOc1ccccc1-c1nc(CC(=O)NCCCOC(C)c2ccccc2)cs1 |
| InChI | InChI=1S/C24H28N2O3S/c1-3-28-22-13-8-7-12-21(22)24-26-20(17-30-24)16-23(27)25-14-9-15-29-18(2)19-10-5-4-6-11-19/h4-8,10-13,17-18H,3,9,14-16H2,1-2H3,(H,25,27) |
| InChIKey | YDTBJRVAHARPLE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|