C20H22N2O3S — CID 51886493
2-[2-(furan-2-yl)-1,3-thiazol-4-yl]-N-[3-[(1R)-1-phenylethoxy]propyl]acetamide (PubChem CID 51886493) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]-N-[3-[(1R)-1-phenylethoxy]propyl]acetamide.
| Compound Name | 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]-N-[3-[(1R)-1-phenylethoxy]propyl]acetamide |
|---|---|
| PubChem CID | 51886493 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]-N-[3-[(1R)-1-phenylethoxy]propyl]acetamide |
| SMILES | C[C@@H](OCCCNC(=O)Cc1csc(-c2ccco2)n1)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-15(16-7-3-2-4-8-16)24-12-6-10-21-19(23)13-17-14-26-20(22-17)18-9-5-11-25-18/h2-5,7-9,11,14-15H,6,10,12-13H2,1H3,(H,21,23)/t15-/m1/s1 |
| InChIKey | MGQNFRZILOFINA-OAHLLOKOSA-N |
| XLogP | 4.23 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|