C16H27F3IN5O — CID 111223842
2-(3-ethoxypropyl)-1-ethyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide (PubChem CID 111223842) has the molecular formula C16H27F3IN5O and a molecular weight of 489.32 g/mol. Its IUPAC name is 2-(3-ethoxypropyl)-1-ethyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 2-(3-ethoxypropyl)-1-ethyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111223842 |
| Molecular Formula | C16H27F3IN5O |
| Molecular Weight | 489.32 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 2-(3-ethoxypropyl)-1-ethyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC)NCCNc1ncccc1C(F)(F)F.I |
| InChI | InChI=1S/C16H26F3N5O.HI/c1-3-20-15(23-9-6-12-25-4-2)24-11-10-22-14-13(16(17,18)19)7-5-8-21-14;/h5,7-8H,3-4,6,9-12H2,1-2H3,(H,21,22)(H2,20,23,24);1H |
| InChIKey | GZJXEWMRUOQJHM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|