C14H19F6IN4O — CID 109473320
1-ethyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109473320) has the molecular formula C14H19F6IN4O and a molecular weight of 500.23 g/mol. Its IUPAC name is 1-ethyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109473320 |
| Molecular Formula | C14H19F6IN4O |
| Molecular Weight | 500.23 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | 1-ethyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC(F)(F)F)NCCOc1ncccc1C(F)(F)F.I |
| InChI | InChI=1S/C14H18F6N4O.HI/c1-2-21-12(23-7-5-13(15,16)17)24-8-9-25-11-10(14(18,19)20)4-3-6-22-11;/h3-4,6H,2,5,7-9H2,1H3,(H2,21,23,24);1H |
| InChIKey | AIQUDWIFGQXAIO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|