C17H21F3IN3O2 — CID 110937751
1-ethyl-2-(furan-2-ylmethyl)-3-[2-[4-(trifluoromethyl)phenoxy]ethyl]guanidine;hydroiodide (PubChem CID 110937751) has the molecular formula C17H21F3IN3O2 and a molecular weight of 483.27 g/mol. Its IUPAC name is 1-ethyl-2-(furan-2-ylmethyl)-3-[2-[4-(trifluoromethyl)phenoxy]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(furan-2-ylmethyl)-3-[2-[4-(trifluoromethyl)phenoxy]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110937751 |
| Molecular Formula | C17H21F3IN3O2 |
| Molecular Weight | 483.27 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | 1-ethyl-2-(furan-2-ylmethyl)-3-[2-[4-(trifluoromethyl)phenoxy]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccco1)NCCOc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C17H20F3N3O2.HI/c1-2-21-16(23-12-15-4-3-10-24-15)22-9-11-25-14-7-5-13(6-8-14)17(18,19)20;/h3-8,10H,2,9,11-12H2,1H3,(H2,21,22,23);1H |
| InChIKey | SQPJWLLIBJTDQB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|