C15H28IN3O2 — CID 110938719
1-ethyl-2-(furan-2-ylmethyl)-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide (PubChem CID 110938719) has the molecular formula C15H28IN3O2 and a molecular weight of 409.31 g/mol. Its IUPAC name is 1-ethyl-2-(furan-2-ylmethyl)-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(furan-2-ylmethyl)-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110938719 |
| Molecular Formula | C15H28IN3O2 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 1-ethyl-2-(furan-2-ylmethyl)-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccco1)NCCCOCC(C)C.I |
| InChI | InChI=1S/C15H27N3O2.HI/c1-4-16-15(18-11-14-7-5-10-20-14)17-8-6-9-19-12-13(2)3;/h5,7,10,13H,4,6,8-9,11-12H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | PYNLWKVWNOLEMP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|