C19H28IN3O2 — CID 110938885
1-ethyl-2-(furan-2-ylmethyl)-3-[3-(2-phenylethoxy)propyl]guanidine;hydroiodide (PubChem CID 110938885) has the molecular formula C19H28IN3O2 and a molecular weight of 457.36 g/mol. Its IUPAC name is 1-ethyl-2-(furan-2-ylmethyl)-3-[3-(2-phenylethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(furan-2-ylmethyl)-3-[3-(2-phenylethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110938885 |
| Molecular Formula | C19H28IN3O2 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 1-ethyl-2-(furan-2-ylmethyl)-3-[3-(2-phenylethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccco1)NCCCOCCc1ccccc1.I |
| InChI | InChI=1S/C19H27N3O2.HI/c1-2-20-19(22-16-18-10-6-14-24-18)21-12-7-13-23-15-11-17-8-4-3-5-9-17;/h3-6,8-10,14H,2,7,11-13,15-16H2,1H3,(H2,20,21,22);1H |
| InChIKey | GRJBGEZAXTZFDX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|