C17H22IN3O4 — CID 110937367
1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-ethyl-2-(furan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110937367) has the molecular formula C17H22IN3O4 and a molecular weight of 459.28 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-ethyl-2-(furan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-ethyl-2-(furan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110937367 |
| Molecular Formula | C17H22IN3O4 |
| Molecular Weight | 459.28 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-ethyl-2-(furan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccco1)NCCOc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C17H21N3O4.HI/c1-2-18-17(20-11-14-4-3-8-21-14)19-7-9-22-13-5-6-15-16(10-13)24-12-23-15;/h3-6,8,10H,2,7,9,11-12H2,1H3,(H2,18,19,20);1H |
| InChIKey | BXLPOIGASZMPQP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|