C21H29F3IN3O4 — CID 111399864
1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]guanidine;hydroiodide (PubChem CID 111399864) has the molecular formula C21H29F3IN3O4 and a molecular weight of 571.38 g/mol. Its IUPAC name is 1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111399864 |
| Molecular Formula | C21H29F3IN3O4 |
| Molecular Weight | 571.38 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | 1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)COc1ccc(C(F)(F)F)cc1)NCCCOCc1ccco1.I |
| InChI | InChI=1S/C21H28F3N3O4.HI/c1-2-25-20(26-10-4-11-29-15-19-5-3-12-30-19)27-13-17(28)14-31-18-8-6-16(7-9-18)21(22,23)24;/h3,5-9,12,17,28H,2,4,10-11,13-15H2,1H3,(H2,25,26,27);1H |
| InChIKey | BZQLSKIPHYUXCV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|