C19H31F3IN3O4 — CID 111406334
1-ethyl-2-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-3-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide (PubChem CID 111406334) has the molecular formula C19H31F3IN3O4 and a molecular weight of 549.37 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-3-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-3-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111406334 |
| Molecular Formula | C19H31F3IN3O4 |
| Molecular Weight | 549.37 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-3-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)COc1ccc(C(F)(F)F)cc1)NCCCOCCOC.I |
| InChI | InChI=1S/C19H30F3N3O4.HI/c1-3-23-18(24-9-4-10-28-12-11-27-2)25-13-16(26)14-29-17-7-5-15(6-8-17)19(20,21)22;/h5-8,16,26H,3-4,9-14H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | DCDOUCRCSNOUHO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|