C16H27I2N3O3 — CID 110975748
1-ethyl-2-[2-hydroxy-3-(4-iodophenoxy)propyl]-3-(3-methoxypropyl)guanidine;hydroiodide (PubChem CID 110975748) has the molecular formula C16H27I2N3O3 and a molecular weight of 563.22 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-3-(4-iodophenoxy)propyl]-3-(3-methoxypropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-hydroxy-3-(4-iodophenoxy)propyl]-3-(3-methoxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110975748 |
| Molecular Formula | C16H27I2N3O3 |
| Molecular Weight | 563.22 g/mol |
| Exact Mass | 563.01 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-3-(4-iodophenoxy)propyl]-3-(3-methoxypropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)COc1ccc(I)cc1)NCCCOC.I |
| InChI | InChI=1S/C16H26IN3O3.HI/c1-3-18-16(19-9-4-10-22-2)20-11-14(21)12-23-15-7-5-13(17)6-8-15;/h5-8,14,21H,3-4,9-12H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | ZTWWQAZJVAFXAL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|