C19H23ClN4O3 — CID 108561509
2-chloroethyl 4-[(2,3-dimethylquinoxaline-6-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 108561509) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is 2-chloroethyl 4-[(2,3-dimethylquinoxaline-6-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | 2-chloroethyl 4-[(2,3-dimethylquinoxaline-6-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108561509 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-chloroethyl 4-[(2,3-dimethylquinoxaline-6-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | Cc1nc2ccc(C(=O)NC3CCN(C(=O)OCCCl)CC3)cc2nc1C |
| InChI | InChI=1S/C19H23ClN4O3/c1-12-13(2)22-17-11-14(3-4-16(17)21-12)18(25)23-15-5-8-24(9-6-15)19(26)27-10-7-20/h3-4,11,15H,5-10H2,1-2H3,(H,23,25) |
| InChIKey | HULDFROIOGJGJK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|