C30H30N4O4 — CID 136727445
7-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-3-[2-hydroxy-2-(4-methoxyphenyl)ethenyl]-1H-quinoxalin-2-one (PubChem CID 136727445) has the molecular formula C30H30N4O4 and a molecular weight of 510.59 g/mol. Its IUPAC name is 7-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-3-[2-hydroxy-2-(4-methoxyphenyl)ethenyl]-1H-quinoxalin-2-one.
| Compound Name | 7-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-3-[2-hydroxy-2-(4-methoxyphenyl)ethenyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 136727445 |
| Molecular Formula | C30H30N4O4 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 7-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-3-[2-hydroxy-2-(4-methoxyphenyl)ethenyl]-1H-quinoxalin-2-one |
| SMILES | COc1ccc(C(O)=Cc2nc3ccc(C(=O)N4CCN(c5cccc(C)c5C)CC4)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C30H30N4O4/c1-19-5-4-6-27(20(19)2)33-13-15-34(16-14-33)30(37)22-9-12-24-25(17-22)32-29(36)26(31-24)18-28(35)21-7-10-23(38-3)11-8-21/h4-12,17-18,35H,13-16H2,1-3H3,(H,32,36) |
| InChIKey | NLZCOGJWAGFDBA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 98.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|