C29H27ClN4O3 — CID 135949253
3-[(Z)-2-(4-chlorophenyl)-2-hydroxyethenyl]-7-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-1H-quinoxalin-2-one (PubChem CID 135949253) has the molecular formula C29H27ClN4O3 and a molecular weight of 515.01 g/mol. Its IUPAC name is 3-[(Z)-2-(4-chlorophenyl)-2-hydroxyethenyl]-7-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-1H-quinoxalin-2-one.
| Compound Name | 3-[(Z)-2-(4-chlorophenyl)-2-hydroxyethenyl]-7-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 135949253 |
| Molecular Formula | C29H27ClN4O3 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 3-[(Z)-2-(4-chlorophenyl)-2-hydroxyethenyl]-7-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-1H-quinoxalin-2-one |
| SMILES | Cc1cccc(N2CCN(C(=O)c3ccc4nc(/C=C(\O)c5ccc(Cl)cc5)c(=O)[nH]c4c3)CC2)c1C |
| InChI | InChI=1S/C29H27ClN4O3/c1-18-4-3-5-26(19(18)2)33-12-14-34(15-13-33)29(37)21-8-11-23-24(16-21)32-28(36)25(31-23)17-27(35)20-6-9-22(30)10-7-20/h3-11,16-17,35H,12-15H2,1-2H3,(H,32,36)/b27-17- |
| InChIKey | UBGYFWIIUFBPGE-PKAZHMFMSA-N |
| XLogP | 5.21 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|