C22H24N4O4 — CID 135899756
2-[[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]methyl]-3H-quinazolin-4-one (PubChem CID 135899756) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 2-[[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135899756 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-[[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]methyl]-3H-quinazolin-4-one |
| SMILES | COc1ccc(C(=O)N2CCN(Cc3nc4ccccc4c(=O)[nH]3)CC2)cc1OC |
| InChI | InChI=1S/C22H24N4O4/c1-29-18-8-7-15(13-19(18)30-2)22(28)26-11-9-25(10-12-26)14-20-23-17-6-4-3-5-16(17)21(27)24-20/h3-8,13H,9-12,14H2,1-2H3,(H,23,24,27) |
| InChIKey | WIOXKFFIIGQNMH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |