C19H35N3O6 — CID 168872932
tert-butyl (2S,4R)-2-carbamoyl-4-[(8-hydroxy-8-methoxyoctanoyl)amino]pyrrolidine-1-carboxylate (PubChem CID 168872932) has the molecular formula C19H35N3O6 and a molecular weight of 401.50 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-carbamoyl-4-[(8-hydroxy-8-methoxyoctanoyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-carbamoyl-4-[(8-hydroxy-8-methoxyoctanoyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 168872932 |
| Molecular Formula | C19H35N3O6 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | tert-butyl (2S,4R)-2-carbamoyl-4-[(8-hydroxy-8-methoxyoctanoyl)amino]pyrrolidine-1-carboxylate |
| SMILES | COC(O)CCCCCCC(=O)N[C@@H]1C[C@@H](C(N)=O)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H35N3O6/c1-19(2,3)28-18(26)22-12-13(11-14(22)17(20)25)21-15(23)9-7-5-6-8-10-16(24)27-4/h13-14,16,24H,5-12H2,1-4H3,(H2,20,25)(H,21,23)/t13-,14+,16?/m1/s1 |
| InChIKey | BWLKDUFSWXXQDB-CNYCQXTOSA-N |
| XLogP | 1.27 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|