C30H38F2N2O5 — CID 70333018
1-O-tert-butyl 2-O-ethyl (2S)-4-[6,6-bis(4-fluorophenyl)hexanoylamino]pyrrolidine-1,2-dicarboxylate (PubChem CID 70333018) has the molecular formula C30H38F2N2O5 and a molecular weight of 544.64 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl (2S)-4-[6,6-bis(4-fluorophenyl)hexanoylamino]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl (2S)-4-[6,6-bis(4-fluorophenyl)hexanoylamino]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 70333018 |
| Molecular Formula | C30H38F2N2O5 |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl (2S)-4-[6,6-bis(4-fluorophenyl)hexanoylamino]pyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CC(NC(=O)CCCCC(c2ccc(F)cc2)c2ccc(F)cc2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H38F2N2O5/c1-5-38-28(36)26-18-24(19-34(26)29(37)39-30(2,3)4)33-27(35)9-7-6-8-25(20-10-14-22(31)15-11-20)21-12-16-23(32)17-13-21/h10-17,24-26H,5-9,18-19H2,1-4H3,(H,33,35)/t24?,26-/m0/s1 |
| InChIKey | DSVOLVKNGVYVOD-JKGBFCRXSA-N |
| XLogP | 5.71 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|