C37H44F2N2O4 — CID 10371656
1-[6,6-bis(4-fluorophenyl)hexanoyl]-4-(3,5-ditert-butyl-4-hydroxybenzoyl)piperazin-2-one (PubChem CID 10371656) has the molecular formula C37H44F2N2O4 and a molecular weight of 618.77 g/mol. Its IUPAC name is 1-[6,6-bis(4-fluorophenyl)hexanoyl]-4-(3,5-ditert-butyl-4-hydroxybenzoyl)piperazin-2-one.
| Compound Name | 1-[6,6-bis(4-fluorophenyl)hexanoyl]-4-(3,5-ditert-butyl-4-hydroxybenzoyl)piperazin-2-one |
|---|---|
| PubChem CID | 10371656 |
| Molecular Formula | C37H44F2N2O4 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.33 |
| IUPAC Name | 1-[6,6-bis(4-fluorophenyl)hexanoyl]-4-(3,5-ditert-butyl-4-hydroxybenzoyl)piperazin-2-one |
| SMILES | CC(C)(C)c1cc(C(=O)N2CCN(C(=O)CCCCC(c3ccc(F)cc3)c3ccc(F)cc3)C(=O)C2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C37H44F2N2O4/c1-36(2,3)30-21-26(22-31(34(30)44)37(4,5)6)35(45)40-19-20-41(33(43)23-40)32(42)10-8-7-9-29(24-11-15-27(38)16-12-24)25-13-17-28(39)18-14-25/h11-18,21-22,29,44H,7-10,19-20,23H2,1-6H3 |
| InChIKey | CWOYRMQVUCWPTB-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|