C38H52F2N2O — CID 11478858
4-[[[1-[6,6-bis(4-fluorophenyl)hexyl]pyrrolidin-3-yl]methylamino]methyl]-2,6-ditert-butylphenol (PubChem CID 11478858) has the molecular formula C38H52F2N2O and a molecular weight of 590.84 g/mol. Its IUPAC name is 4-[[[1-[6,6-bis(4-fluorophenyl)hexyl]pyrrolidin-3-yl]methylamino]methyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[[[1-[6,6-bis(4-fluorophenyl)hexyl]pyrrolidin-3-yl]methylamino]methyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 11478858 |
| Molecular Formula | C38H52F2N2O |
| Molecular Weight | 590.84 g/mol |
| Exact Mass | 590.40 |
| IUPAC Name | 4-[[[1-[6,6-bis(4-fluorophenyl)hexyl]pyrrolidin-3-yl]methylamino]methyl]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(CNCC2CCN(CCCCCC(c3ccc(F)cc3)c3ccc(F)cc3)C2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C38H52F2N2O/c1-37(2,3)34-22-28(23-35(36(34)43)38(4,5)6)25-41-24-27-19-21-42(26-27)20-9-7-8-10-33(29-11-15-31(39)16-12-29)30-13-17-32(40)18-14-30/h11-18,22-23,27,33,41,43H,7-10,19-21,24-26H2,1-6H3 |
| InChIKey | IAADTHQACMECFU-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.84 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|