C23H30ClNO2 — CID 70478194
2-[1-(5,5-diphenylpentyl)pyrrolidin-3-yl]acetic acid;hydrochloride (PubChem CID 70478194) has the molecular formula C23H30ClNO2 and a molecular weight of 387.95 g/mol. Its IUPAC name is 2-[1-(5,5-diphenylpentyl)pyrrolidin-3-yl]acetic acid;hydrochloride.
| Compound Name | 2-[1-(5,5-diphenylpentyl)pyrrolidin-3-yl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 70478194 |
| Molecular Formula | C23H30ClNO2 |
| Molecular Weight | 387.95 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2-[1-(5,5-diphenylpentyl)pyrrolidin-3-yl]acetic acid;hydrochloride |
| SMILES | Cl.O=C(O)CC1CCN(CCCCC(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C23H29NO2.ClH/c25-23(26)17-19-14-16-24(18-19)15-8-7-13-22(20-9-3-1-4-10-20)21-11-5-2-6-12-21;/h1-6,9-12,19,22H,7-8,13-18H2,(H,25,26);1H |
| InChIKey | QHUGTAPGKKEXAJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.95 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|