C30H31ClF2N2O3 — CID 11720839
N-[(E)-4-[[2-(4-chlorophenoxy)acetyl]amino]but-2-enyl]-6,6-bis(4-fluorophenyl)hexanamide (PubChem CID 11720839) has the molecular formula C30H31ClF2N2O3 and a molecular weight of 541.04 g/mol. Its IUPAC name is N-[(E)-4-[[2-(4-chlorophenoxy)acetyl]amino]but-2-enyl]-6,6-bis(4-fluorophenyl)hexanamide.
| Compound Name | N-[(E)-4-[[2-(4-chlorophenoxy)acetyl]amino]but-2-enyl]-6,6-bis(4-fluorophenyl)hexanamide |
|---|---|
| PubChem CID | 11720839 |
| Molecular Formula | C30H31ClF2N2O3 |
| Molecular Weight | 541.04 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | N-[(E)-4-[[2-(4-chlorophenoxy)acetyl]amino]but-2-enyl]-6,6-bis(4-fluorophenyl)hexanamide |
| SMILES | O=C(CCCCC(c1ccc(F)cc1)c1ccc(F)cc1)NC/C=C/CNC(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H31ClF2N2O3/c31-24-11-17-27(18-12-24)38-21-30(37)35-20-4-3-19-34-29(36)6-2-1-5-28(22-7-13-25(32)14-8-22)23-9-15-26(33)16-10-23/h3-4,7-18,28H,1-2,5-6,19-21H2,(H,34,36)(H,35,37)/b4-3+ |
| InChIKey | VVQIHISRDRLLMI-ONEGZZNKSA-N |
| XLogP | 6.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.04 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|