C26H42N2O2 — CID 143274591
3,5-ditert-butyl-N-[(E)-4-(hexanoylamino)but-2-enyl]-4-methylbenzamide (PubChem CID 143274591) has the molecular formula C26H42N2O2 and a molecular weight of 414.63 g/mol. Its IUPAC name is 3,5-ditert-butyl-N-[(E)-4-(hexanoylamino)but-2-enyl]-4-methylbenzamide.
| Compound Name | 3,5-ditert-butyl-N-[(E)-4-(hexanoylamino)but-2-enyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 143274591 |
| Molecular Formula | C26H42N2O2 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | 3,5-ditert-butyl-N-[(E)-4-(hexanoylamino)but-2-enyl]-4-methylbenzamide |
| SMILES | CCCCCC(=O)NC/C=C/CNC(=O)c1cc(C(C)(C)C)c(C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H42N2O2/c1-9-10-11-14-23(29)27-15-12-13-16-28-24(30)20-17-21(25(3,4)5)19(2)22(18-20)26(6,7)8/h12-13,17-18H,9-11,14-16H2,1-8H3,(H,27,29)(H,28,30)/b13-12+ |
| InChIKey | JQDVZFYKXZRGNF-OUKQBFOZSA-N |
| XLogP | 5.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|