C15H23N5O2S — CID 9214234
2-[2-[3-(dimethylamino)propylcarbamothioyl]hydrazinyl]-N-(4-methylphenyl)-2-oxoacetamide (PubChem CID 9214234) has the molecular formula C15H23N5O2S and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-[2-[3-(dimethylamino)propylcarbamothioyl]hydrazinyl]-N-(4-methylphenyl)-2-oxoacetamide.
| Compound Name | 2-[2-[3-(dimethylamino)propylcarbamothioyl]hydrazinyl]-N-(4-methylphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 9214234 |
| Molecular Formula | C15H23N5O2S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-[2-[3-(dimethylamino)propylcarbamothioyl]hydrazinyl]-N-(4-methylphenyl)-2-oxoacetamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NNC(=S)NCCCN(C)C)cc1 |
| InChI | InChI=1S/C15H23N5O2S/c1-11-5-7-12(8-6-11)17-13(21)14(22)18-19-15(23)16-9-4-10-20(2)3/h5-8H,4,9-10H2,1-3H3,(H,17,21)(H,18,22)(H2,16,19,23) |
| InChIKey | DQUJJJRFDJELMY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|