C13H18N2O — CID 5188255
1-(cyclopropylmethyl)-3-(3,5-dimethylphenyl)urea (PubChem CID 5188255) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-(3,5-dimethylphenyl)urea.
| Compound Name | 1-(cyclopropylmethyl)-3-(3,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 5188255 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-(3,5-dimethylphenyl)urea |
| SMILES | Cc1cc(C)cc(NC(=O)NCC2CC2)c1 |
| InChI | InChI=1S/C13H18N2O/c1-9-5-10(2)7-12(6-9)15-13(16)14-8-11-3-4-11/h5-7,11H,3-4,8H2,1-2H3,(H2,14,15,16) |
| InChIKey | MNNHHUGIMQJFRE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |