C16H24N2O2 — CID 108912803
1-(oxan-4-ylmethyl)-3-(2,4,6-trimethylphenyl)urea (PubChem CID 108912803) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-(oxan-4-ylmethyl)-3-(2,4,6-trimethylphenyl)urea.
| Compound Name | 1-(oxan-4-ylmethyl)-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| PubChem CID | 108912803 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-(oxan-4-ylmethyl)-3-(2,4,6-trimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)NCC2CCOCC2)c(C)c1 |
| InChI | InChI=1S/C16H24N2O2/c1-11-8-12(2)15(13(3)9-11)18-16(19)17-10-14-4-6-20-7-5-14/h8-9,14H,4-7,10H2,1-3H3,(H2,17,18,19) |
| InChIKey | GEGQYGLBDDFFHX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |