C16H19N3O2 — CID 61346268
1-[4-(1-hydroxyethyl)phenyl]-3-(2-pyridin-2-ylethyl)urea (PubChem CID 61346268) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-[4-(1-hydroxyethyl)phenyl]-3-(2-pyridin-2-ylethyl)urea.
| Compound Name | 1-[4-(1-hydroxyethyl)phenyl]-3-(2-pyridin-2-ylethyl)urea |
|---|---|
| PubChem CID | 61346268 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-[4-(1-hydroxyethyl)phenyl]-3-(2-pyridin-2-ylethyl)urea |
| SMILES | CC(O)c1ccc(NC(=O)NCCc2ccccn2)cc1 |
| InChI | InChI=1S/C16H19N3O2/c1-12(20)13-5-7-15(8-6-13)19-16(21)18-11-9-14-4-2-3-10-17-14/h2-8,10,12,20H,9,11H2,1H3,(H2,18,19,21) |
| InChIKey | YWVJFEDALAZCEI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |