C15H15F2N3OS — CID 75520831
1-(3,5-difluoro-4-methylsulfanylphenyl)-3-(2-pyridin-2-ylethyl)urea (PubChem CID 75520831) has the molecular formula C15H15F2N3OS and a molecular weight of 323.37 g/mol. Its IUPAC name is 1-(3,5-difluoro-4-methylsulfanylphenyl)-3-(2-pyridin-2-ylethyl)urea.
| Compound Name | 1-(3,5-difluoro-4-methylsulfanylphenyl)-3-(2-pyridin-2-ylethyl)urea |
|---|---|
| PubChem CID | 75520831 |
| Molecular Formula | C15H15F2N3OS |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 1-(3,5-difluoro-4-methylsulfanylphenyl)-3-(2-pyridin-2-ylethyl)urea |
| SMILES | CSc1c(F)cc(NC(=O)NCCc2ccccn2)cc1F |
| InChI | InChI=1S/C15H15F2N3OS/c1-22-14-12(16)8-11(9-13(14)17)20-15(21)19-7-5-10-4-2-3-6-18-10/h2-4,6,8-9H,5,7H2,1H3,(H2,19,20,21) |
| InChIKey | HQGGOPAEPSZEGG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |