C14H11F3N2O4S — CID 155294955
2-[[4-(trifluoromethyl)phenyl]carbamoylamino]benzenesulfonic acid (PubChem CID 155294955) has the molecular formula C14H11F3N2O4S and a molecular weight of 360.31 g/mol. Its IUPAC name is 2-[[4-(trifluoromethyl)phenyl]carbamoylamino]benzenesulfonic acid.
| Compound Name | 2-[[4-(trifluoromethyl)phenyl]carbamoylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 155294955 |
| Molecular Formula | C14H11F3N2O4S |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 2-[[4-(trifluoromethyl)phenyl]carbamoylamino]benzenesulfonic acid |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)Nc1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C14H11F3N2O4S/c15-14(16,17)9-5-7-10(8-6-9)18-13(20)19-11-3-1-2-4-12(11)24(21,22)23/h1-8H,(H2,18,19,20)(H,21,22,23) |
| InChIKey | DFWQHZOWHIDPBX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|