C14H19F2NO3 — CID 107318607
2-[4-(difluoromethoxy)phenyl]-N-(5-hydroxypentyl)acetamide (PubChem CID 107318607) has the molecular formula C14H19F2NO3 and a molecular weight of 287.31 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)phenyl]-N-(5-hydroxypentyl)acetamide.
| Compound Name | 2-[4-(difluoromethoxy)phenyl]-N-(5-hydroxypentyl)acetamide |
|---|---|
| PubChem CID | 107318607 |
| Molecular Formula | C14H19F2NO3 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-[4-(difluoromethoxy)phenyl]-N-(5-hydroxypentyl)acetamide |
| SMILES | O=C(Cc1ccc(OC(F)F)cc1)NCCCCCO |
| InChI | InChI=1S/C14H19F2NO3/c15-14(16)20-12-6-4-11(5-7-12)10-13(19)17-8-2-1-3-9-18/h4-7,14,18H,1-3,8-10H2,(H,17,19) |
| InChIKey | GTBFZRBMGXLFJG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|