C19H32IN5O2S — CID 111910640
2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-(1-phenylpyrrolidin-3-yl)guanidine;hydroiodide (PubChem CID 111910640) has the molecular formula C19H32IN5O2S and a molecular weight of 521.47 g/mol. Its IUPAC name is 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-(1-phenylpyrrolidin-3-yl)guanidine;hydroiodide.
| Compound Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-(1-phenylpyrrolidin-3-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111910640 |
| Molecular Formula | C19H32IN5O2S |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-(1-phenylpyrrolidin-3-yl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCS(=O)(=O)CC1)NC1CCN(c2ccccc2)C1.I |
| InChI | InChI=1S/C19H31N5O2S.HI/c1-2-20-19(21-9-11-23-12-14-27(25,26)15-13-23)22-17-8-10-24(16-17)18-6-4-3-5-7-18;/h3-7,17H,2,8-16H2,1H3,(H2,20,21,22);1H |
| InChIKey | SBPQDLHOMTUPJD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|