C18H34F3N5 — CID 111915905
2-[2-[cyclohexyl(methyl)amino]ethyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111915905) has the molecular formula C18H34F3N5 and a molecular weight of 377.50 g/mol. Its IUPAC name is 2-[2-[cyclohexyl(methyl)amino]ethyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 2-[2-[cyclohexyl(methyl)amino]ethyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111915905 |
| Molecular Formula | C18H34F3N5 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.28 |
| IUPAC Name | 2-[2-[cyclohexyl(methyl)amino]ethyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | CCN/C(=N\CCN(C)C1CCCCC1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C18H34F3N5/c1-3-22-17(23-10-12-25(2)16-7-5-4-6-8-16)24-15-9-11-26(13-15)14-18(19,20)21/h15-16H,3-14H2,1-2H3,(H2,22,23,24) |
| InChIKey | KKWGIIVGQJIJLO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|